C10H10FNO3S — CID 115731719
3-fluoro-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 115731719) has the molecular formula C10H10FNO3S and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-fluoro-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115731719 |
| Molecular Formula | C10H10FNO3S |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 3-fluoro-1-(thiophene-2-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(c1cccs1)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C10H10FNO3S/c11-10(9(14)15)3-4-12(6-10)8(13)7-2-1-5-16-7/h1-2,5H,3-4,6H2,(H,14,15) |
| InChIKey | OYWCEFDXAPJTMA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |