C13H18N2OS — CID 124554551
[(5R)-2,7-diazaspiro[4.5]decan-7-yl]-thiophen-2-ylmethanone (PubChem CID 124554551) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is [(5R)-2,7-diazaspiro[4.5]decan-7-yl]-thiophen-2-ylmethanone.
| Compound Name | [(5R)-2,7-diazaspiro[4.5]decan-7-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 124554551 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(5R)-2,7-diazaspiro[4.5]decan-7-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC[C@]2(CCNC2)C1 |
| InChI | InChI=1S/C13H18N2OS/c16-12(11-3-1-8-17-11)15-7-2-4-13(10-15)5-6-14-9-13/h1,3,8,14H,2,4-7,9-10H2/t13-/m1/s1 |
| InChIKey | LYIDTNGQPGOVNM-CYBMUJFWSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |