C10H11FN2O5S2 — CID 119259509
3-fluoro-1-(5-sulfamoylthiophene-3-carbonyl)pyrrolidine-3-carboxylic acid (PubChem CID 119259509) has the molecular formula C10H11FN2O5S2 and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-fluoro-1-(5-sulfamoylthiophene-3-carbonyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(5-sulfamoylthiophene-3-carbonyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259509 |
| Molecular Formula | C10H11FN2O5S2 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-fluoro-1-(5-sulfamoylthiophene-3-carbonyl)pyrrolidine-3-carboxylic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)N2CCC(F)(C(=O)O)C2)cs1 |
| InChI | InChI=1S/C10H11FN2O5S2/c11-10(9(15)16)1-2-13(5-10)8(14)6-3-7(19-4-6)20(12,17)18/h3-4H,1-2,5H2,(H,15,16)(H2,12,17,18) |
| InChIKey | DOYGJWHKZVWSAF-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |