C14H17FN2O5S — CID 119259421
1-(3,4-dimethyl-5-sulfamoylbenzoyl)-3-fluoropyrrolidine-3-carboxylic acid (PubChem CID 119259421) has the molecular formula C14H17FN2O5S and a molecular weight of 344.36 g/mol. Its IUPAC name is 1-(3,4-dimethyl-5-sulfamoylbenzoyl)-3-fluoropyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,4-dimethyl-5-sulfamoylbenzoyl)-3-fluoropyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119259421 |
| Molecular Formula | C14H17FN2O5S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 1-(3,4-dimethyl-5-sulfamoylbenzoyl)-3-fluoropyrrolidine-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)N2CCC(F)(C(=O)O)C2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C14H17FN2O5S/c1-8-5-10(6-11(9(8)2)23(16,21)22)12(18)17-4-3-14(15,7-17)13(19)20/h5-6H,3-4,7H2,1-2H3,(H,19,20)(H2,16,21,22) |
| InChIKey | YENALAONHSVFHE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |