C30H38BFN4O3 — CID 140862290
[2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-(1-methylcyclopropyl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone (PubChem CID 140862290) has the molecular formula C30H38BFN4O3 and a molecular weight of 532.47 g/mol. Its IUPAC name is [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-(1-methylcyclopropyl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone.
| Compound Name | [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-(1-methylcyclopropyl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 140862290 |
| Molecular Formula | C30H38BFN4O3 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | [2-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-(1-methylcyclopropyl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone |
| SMILES | C[C@@H]1CCCCCN1C(=O)c1cc(C2(C)CC2)n2nc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3F)cc2n1 |
| InChI | InChI=1S/C30H38BFN4O3/c1-19-10-8-7-9-15-35(19)27(37)24-17-25(30(6)13-14-30)36-26(33-24)18-23(34-36)21-12-11-20(16-22(21)32)31-38-28(2,3)29(4,5)39-31/h11-12,16-19H,7-10,13-15H2,1-6H3/t19-/m1/s1 |
| InChIKey | KYSQMJTZEMSWGT-LJQANCHMSA-N |
| XLogP | 5.29 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|