C23H33BN4O3 — CID 140862326
[7-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone (PubChem CID 140862326) has the molecular formula C23H33BN4O3 and a molecular weight of 424.35 g/mol. Its IUPAC name is [7-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone.
| Compound Name | [7-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 140862326 |
| Molecular Formula | C23H33BN4O3 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [7-cyclopropyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyrimidin-5-yl]-[(2R)-2-methylazepan-1-yl]methanone |
| SMILES | C[C@@H]1CCCCCN1C(=O)c1cc(C2CC2)n2nc(B3OC(C)(C)C(C)(C)O3)cc2n1 |
| InChI | InChI=1S/C23H33BN4O3/c1-15-9-7-6-8-12-27(15)21(29)17-13-18(16-10-11-16)28-20(25-17)14-19(26-28)24-30-22(2,3)23(4,5)31-24/h13-16H,6-12H2,1-5H3/t15-/m1/s1 |
| InChIKey | QFGRNCWHYQJODM-OAHLLOKOSA-N |
| XLogP | 3.31 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|