C13H16FN3O3 — CID 115312191
(4-amino-2-methylpiperidin-1-yl)-(2-fluoro-5-nitrophenyl)methanone (PubChem CID 115312191) has the molecular formula C13H16FN3O3 and a molecular weight of 281.29 g/mol. Its IUPAC name is (4-amino-2-methylpiperidin-1-yl)-(2-fluoro-5-nitrophenyl)methanone.
| Compound Name | (4-amino-2-methylpiperidin-1-yl)-(2-fluoro-5-nitrophenyl)methanone |
|---|---|
| PubChem CID | 115312191 |
| Molecular Formula | C13H16FN3O3 |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (4-amino-2-methylpiperidin-1-yl)-(2-fluoro-5-nitrophenyl)methanone |
| SMILES | CC1CC(N)CCN1C(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H16FN3O3/c1-8-6-9(15)4-5-16(8)13(18)11-7-10(17(19)20)2-3-12(11)14/h2-3,7-9H,4-6,15H2,1H3 |
| InChIKey | FUITZXURONVTII-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|