C12H12FN3O5 — CID 83097346
4-(2-fluoro-5-nitrobenzoyl)morpholine-3-carboxamide (PubChem CID 83097346) has the molecular formula C12H12FN3O5 and a molecular weight of 297.24 g/mol. Its IUPAC name is 4-(2-fluoro-5-nitrobenzoyl)morpholine-3-carboxamide.
| Compound Name | 4-(2-fluoro-5-nitrobenzoyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097346 |
| Molecular Formula | C12H12FN3O5 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 4-(2-fluoro-5-nitrobenzoyl)morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1C(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C12H12FN3O5/c13-9-2-1-7(16(19)20)5-8(9)12(18)15-3-4-21-6-10(15)11(14)17/h1-2,5,10H,3-4,6H2,(H2,14,17) |
| InChIKey | YNVPPCKYLUIEDZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|