C19H18N4O7S — CID 175752105
4-(4-cyanophenyl)sulfonyl-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide (PubChem CID 175752105) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is 4-(4-cyanophenyl)sulfonyl-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide.
| Compound Name | 4-(4-cyanophenyl)sulfonyl-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 175752105 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-(4-cyanophenyl)sulfonyl-1-(3,4,5-trihydroxybenzoyl)piperazine-2-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc(O)c(O)c(O)c3)C(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C19H18N4O7S/c20-9-11-1-3-13(4-2-11)31(29,30)22-5-6-23(14(10-22)18(21)27)19(28)12-7-15(24)17(26)16(25)8-12/h1-4,7-8,14,24-26H,5-6,10H2,(H2,21,27) |
| InChIKey | BXPBBIINQIJXFN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 185.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|