C31H33N3O5 — CID 135915941
trans-(2S,4S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(morpholine-4-carbonyl)-2,4-diphenylcyclobutane-1-carboxamide (PubChem CID 135915941) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is trans-(2S,4S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(morpholine-4-carbonyl)-2,4-diphenylcyclobutane-1-carboxamide.
| Compound Name | trans-(2S,4S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(morpholine-4-carbonyl)-2,4-diphenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 135915941 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | trans-(2S,4S)-N-[(Z)-(3-ethoxy-4-hydroxyphenyl)methylideneamino]-3-(morpholine-4-carbonyl)-2,4-diphenylcyclobutane-1-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)C2[C@@H](c3ccccc3)C(C(=O)N3CCOCC3)[C@@H]2c2ccccc2)ccc1O |
| InChI | InChI=1S/C31H33N3O5/c1-2-39-25-19-21(13-14-24(25)35)20-32-33-30(36)28-26(22-9-5-3-6-10-22)29(27(28)23-11-7-4-8-12-23)31(37)34-15-17-38-18-16-34/h3-14,19-20,26-29,35H,2,15-18H2,1H3,(H,33,36)/b32-20-/t26-,27-,28?,29?/m1/s1 |
| InChIKey | ZBXXYEBCWYVYEU-SRGNYHRGSA-N |
| XLogP | 3.91 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|