C25H28N4O2 — CID 94836613
N'-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-[(1R)-1-phenylethyl]oxamide (PubChem CID 94836613) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N'-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-[(1R)-1-phenylethyl]oxamide.
| Compound Name | N'-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-[(1R)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 94836613 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N'-[(Z)-[1-(2,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-N-[(1R)-1-phenylethyl]oxamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=N\NC(=O)C(=O)N[C@H](C)c3ccccc3)c2C)c(C)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-16-11-12-23(17(2)13-16)29-18(3)14-22(20(29)5)15-26-28-25(31)24(30)27-19(4)21-9-7-6-8-10-21/h6-15,19H,1-5H3,(H,27,30)(H,28,31)/b26-15-/t19-/m1/s1 |
| InChIKey | DEEWGEUATOEJMA-APQFFPOMSA-N |
| XLogP | 4.04 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|