C20H27N3O3S — CID 40601128
N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 40601128) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 40601128 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1-(4-methylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(=O)N/N=C\[C@H]3CC=CCC3)CC2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-16-7-9-19(10-8-16)27(25,26)23-13-11-18(12-14-23)20(24)22-21-15-17-5-3-2-4-6-17/h2-3,7-10,15,17-18H,4-6,11-14H2,1H3,(H,22,24)/b21-15-/t17-/m0/s1 |
| InChIKey | PZPVIIZLHMWVOJ-SZHLLGMXSA-N |
| XLogP | 2.85 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|