C26H35N3O4S — CID 23098507
N-[(E)-1-(3-methoxyphenyl)ethylideneamino]-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 23098507) has the molecular formula C26H35N3O4S and a molecular weight of 485.65 g/mol. Its IUPAC name is N-[(E)-1-(3-methoxyphenyl)ethylideneamino]-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[(E)-1-(3-methoxyphenyl)ethylideneamino]-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 23098507 |
| Molecular Formula | C26H35N3O4S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | N-[(E)-1-(3-methoxyphenyl)ethylideneamino]-1-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1cccc(/C(C)=N/NC(=O)C2CCN(S(=O)(=O)c3c(C)c(C)c(C)c(C)c3C)CC2)c1 |
| InChI | InChI=1S/C26H35N3O4S/c1-16-17(2)19(4)25(20(5)18(16)3)34(31,32)29-13-11-22(12-14-29)26(30)28-27-21(6)23-9-8-10-24(15-23)33-7/h8-10,15,22H,11-14H2,1-7H3,(H,28,30)/b27-21+ |
| InChIKey | ZRMPZIOVMJMVSK-SZXQPVLSSA-N |
| XLogP | 4.18 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|