C30H36N4O4S2 — CID 171316398
N-[1-[3-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 171316398) has the molecular formula C30H36N4O4S2 and a molecular weight of 580.78 g/mol. Its IUPAC name is N-[1-[3-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-[3-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 171316398 |
| Molecular Formula | C30H36N4O4S2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | N-[1-[3-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2cccc(C(C)=NNC(=O)C3CCN(S(=O)(=O)c4c(C)cc(C)cc4C)CC3)c2)cs1 |
| InChI | InChI=1S/C30H36N4O4S2/c1-6-27-17-25(18-39-27)29(35)31-26-9-7-8-24(16-26)22(5)32-33-30(36)23-10-12-34(13-11-23)40(37,38)28-20(3)14-19(2)15-21(28)4/h7-9,14-18,23H,6,10-13H2,1-5H3,(H,31,35)(H,33,36) |
| InChIKey | NOLMLTIGPHHBDS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|