C29H34N4O4S2 — CID 17126482
1-(2,5-dimethylphenyl)sulfonyl-N-[(E)-1-[4-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide (PubChem CID 17126482) has the molecular formula C29H34N4O4S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-N-[(E)-1-[4-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-N-[(E)-1-[4-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17126482 |
| Molecular Formula | C29H34N4O4S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-N-[(E)-1-[4-[(5-ethylthiophene-3-carbonyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2ccc(/C(C)=N/NC(=O)C3CCN(S(=O)(=O)c4cc(C)ccc4C)CC3)cc2)cs1 |
| InChI | InChI=1S/C29H34N4O4S2/c1-5-26-17-24(18-38-26)28(34)30-25-10-8-22(9-11-25)21(4)31-32-29(35)23-12-14-33(15-13-23)39(36,37)27-16-19(2)6-7-20(27)3/h6-11,16-18,23H,5,12-15H2,1-4H3,(H,30,34)(H,32,35)/b31-21+ |
| InChIKey | GXCJXYIFHABMSN-NJZRLIGZSA-N |
| XLogP | 5.12 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|