C31H36N4O4S2 — CID 171316407
1-(2,4-dimethylphenyl)sulfonyl-N-[1-[4-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)phenyl]ethylideneamino]piperidine-4-carboxamide (PubChem CID 171316407) has the molecular formula C31H36N4O4S2 and a molecular weight of 592.79 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)sulfonyl-N-[1-[4-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)phenyl]ethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-(2,4-dimethylphenyl)sulfonyl-N-[1-[4-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)phenyl]ethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 171316407 |
| Molecular Formula | C31H36N4O4S2 |
| Molecular Weight | 592.79 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 1-(2,4-dimethylphenyl)sulfonyl-N-[1-[4-(4,5,6,7-tetrahydro-1-benzothiophene-3-carbonylamino)phenyl]ethylideneamino]piperidine-4-carboxamide |
| SMILES | CC(=NNC(=O)C1CCN(S(=O)(=O)c2ccc(C)cc2C)CC1)c1ccc(NC(=O)c2csc3c2CCCC3)cc1 |
| InChI | InChI=1S/C31H36N4O4S2/c1-20-8-13-29(21(2)18-20)41(38,39)35-16-14-24(15-17-35)30(36)34-33-22(3)23-9-11-25(12-10-23)32-31(37)27-19-40-28-7-5-4-6-26(27)28/h8-13,18-19,24H,4-7,14-17H2,1-3H3,(H,32,37)(H,34,36) |
| InChIKey | VWIXENJOMWQWPT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.79 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|