C17H16BrF2N3O6S2 — CID 2110787
N'-(2-bromo-4,6-difluorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 2110787) has the molecular formula C17H16BrF2N3O6S2 and a molecular weight of 540.36 g/mol. Its IUPAC name is N'-(2-bromo-4,6-difluorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | N'-(2-bromo-4,6-difluorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2110787 |
| Molecular Formula | C17H16BrF2N3O6S2 |
| Molecular Weight | 540.36 g/mol |
| Exact Mass | 538.96 |
| IUPAC Name | N'-(2-bromo-4,6-difluorophenyl)sulfonyl-3-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1c(F)cc(F)cc1Br)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H16BrF2N3O6S2/c18-14-9-12(19)10-15(20)16(14)30(25,26)22-21-17(24)11-2-1-3-13(8-11)31(27,28)23-4-6-29-7-5-23/h1-3,8-10,22H,4-7H2,(H,21,24) |
| InChIKey | HUDOTFCZBCRENJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|