C20H20ClN3O6S — CID 24513762
5-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide (PubChem CID 24513762) has the molecular formula C20H20ClN3O6S and a molecular weight of 465.92 g/mol. Its IUPAC name is 5-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide.
| Compound Name | 5-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 24513762 |
| Molecular Formula | C20H20ClN3O6S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 5-chloro-N'-(3-morpholin-4-ylsulfonylbenzoyl)-2,3-dihydro-1-benzofuran-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1Cc2cc(Cl)ccc2O1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H20ClN3O6S/c21-15-4-5-17-14(10-15)12-18(30-17)20(26)23-22-19(25)13-2-1-3-16(11-13)31(27,28)24-6-8-29-9-7-24/h1-5,10-11,18H,6-9,12H2,(H,22,25)(H,23,26) |
| InChIKey | QCOMNENKBBNWON-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|