C20H21FN2OS — CID 55987080
N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-1-prop-2-ynylpiperidine-4-carboxamide (PubChem CID 55987080) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-1-prop-2-ynylpiperidine-4-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-1-prop-2-ynylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55987080 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[(4-fluorophenyl)-thiophen-2-ylmethyl]-1-prop-2-ynylpiperidine-4-carboxamide |
| SMILES | C#CCN1CCC(C(=O)NC(c2ccc(F)cc2)c2cccs2)CC1 |
| InChI | InChI=1S/C20H21FN2OS/c1-2-11-23-12-9-16(10-13-23)20(24)22-19(18-4-3-14-25-18)15-5-7-17(21)8-6-15/h1,3-8,14,16,19H,9-13H2,(H,22,24) |
| InChIKey | PRBBBANHYZDWAX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|