C24H26N2O6 — CID 55817891
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-propanoylpiperidine-3-carboxylate (PubChem CID 55817891) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-propanoylpiperidine-3-carboxylate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-propanoylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55817891 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-propanoylpiperidine-3-carboxylate |
| SMILES | CCC(=O)N1CCCC(C(=O)OCC(=O)Nc2cc3oc4ccccc4c3cc2OC)C1 |
| InChI | InChI=1S/C24H26N2O6/c1-3-23(28)26-10-6-7-15(13-26)24(29)31-14-22(27)25-18-12-20-17(11-21(18)30-2)16-8-4-5-9-19(16)32-20/h4-5,8-9,11-12,15H,3,6-7,10,13-14H2,1-2H3,(H,25,27) |
| InChIKey | LNJDDXIRESUGOW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |