C12H25N3O3S — CID 28567035
(3R)-1-(dimethylsulfamoyl)-N-(2-methylpropyl)piperidine-3-carboxamide (PubChem CID 28567035) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is (3R)-1-(dimethylsulfamoyl)-N-(2-methylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(dimethylsulfamoyl)-N-(2-methylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28567035 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (3R)-1-(dimethylsulfamoyl)-N-(2-methylpropyl)piperidine-3-carboxamide |
| SMILES | CC(C)CNC(=O)[C@@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C12H25N3O3S/c1-10(2)8-13-12(16)11-6-5-7-15(9-11)19(17,18)14(3)4/h10-11H,5-9H2,1-4H3,(H,13,16)/t11-/m1/s1 |
| InChIKey | GJLLXQTZISHOJY-LLVKDONJSA-N |
| XLogP | 0.28 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |