C23H28BClN2O4 — CID 68850355
[3-[[4-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-4-oxobutan-2-yl]carbamoyl]phenyl]boronic acid (PubChem CID 68850355) has the molecular formula C23H28BClN2O4 and a molecular weight of 442.75 g/mol. Its IUPAC name is [3-[[4-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-4-oxobutan-2-yl]carbamoyl]phenyl]boronic acid.
| Compound Name | [3-[[4-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-4-oxobutan-2-yl]carbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 68850355 |
| Molecular Formula | C23H28BClN2O4 |
| Molecular Weight | 442.75 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [3-[[4-[4-(4-chlorophenyl)piperidin-1-yl]-3-methyl-4-oxobutan-2-yl]carbamoyl]phenyl]boronic acid |
| SMILES | CC(NC(=O)c1cccc(B(O)O)c1)C(C)C(=O)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H28BClN2O4/c1-15(16(2)26-22(28)19-4-3-5-20(14-19)24(30)31)23(29)27-12-10-18(11-13-27)17-6-8-21(25)9-7-17/h3-9,14-16,18,30-31H,10-13H2,1-2H3,(H,26,28) |
| InChIKey | OVGBYPVQKYMNRS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|