C26H31ClN2O2 — CID 24758630
N-[(1R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-1-cyclohexyl-2-oxoethyl]benzamide (PubChem CID 24758630) has the molecular formula C26H31ClN2O2 and a molecular weight of 439.00 g/mol. Its IUPAC name is N-[(1R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-1-cyclohexyl-2-oxoethyl]benzamide.
| Compound Name | N-[(1R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-1-cyclohexyl-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 24758630 |
| Molecular Formula | C26H31ClN2O2 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[(1R)-2-[4-(4-chlorophenyl)piperidin-1-yl]-1-cyclohexyl-2-oxoethyl]benzamide |
| SMILES | O=C(N[C@@H](C(=O)N1CCC(c2ccc(Cl)cc2)CC1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H31ClN2O2/c27-23-13-11-19(12-14-23)20-15-17-29(18-16-20)26(31)24(21-7-3-1-4-8-21)28-25(30)22-9-5-2-6-10-22/h2,5-6,9-14,20-21,24H,1,3-4,7-8,15-18H2,(H,28,30)/t24-/m1/s1 |
| InChIKey | MFMVJSBNKQSLTA-XMMPIXPASA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |