C16H14F2N4O4 — CID 24635076
N-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide (PubChem CID 24635076) has the molecular formula C16H14F2N4O4 and a molecular weight of 364.31 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
|---|---|
| PubChem CID | 24635076 |
| Molecular Formula | C16H14F2N4O4 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-2-[(4-fluorophenyl)methylcarbamoylamino]acetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H14F2N4O4/c17-11-3-1-10(2-4-11)8-19-16(24)20-9-15(23)21-12-5-6-13(18)14(7-12)22(25)26/h1-7H,8-9H2,(H,21,23)(H2,19,20,24) |
| InChIKey | WAEORUIMSMKABQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|