C19H16F3N5O3 — CID 133411129
3H-benzimidazol-5-yl-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone (PubChem CID 133411129) has the molecular formula C19H16F3N5O3 and a molecular weight of 419.36 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 133411129 |
| Molecular Formula | C19H16F3N5O3 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3H-benzimidazol-5-yl-[4-[4-nitro-3-(trifluoromethyl)phenyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCN(c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H16F3N5O3/c20-19(21,22)14-10-13(2-4-17(14)27(29)30)25-5-7-26(8-6-25)18(28)12-1-3-15-16(9-12)24-11-23-15/h1-4,9-11H,5-8H2,(H,23,24) |
| InChIKey | SGQNBAJUPUGULN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|