C19H17ClF4N2O3S — CID 17103893
N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide (PubChem CID 17103893) has the molecular formula C19H17ClF4N2O3S and a molecular weight of 464.87 g/mol. Its IUPAC name is N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide.
| Compound Name | N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 17103893 |
| Molecular Formula | C19H17ClF4N2O3S |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[(5-tert-butyl-3-chloro-2-hydroxyphenyl)carbamothioyl]-2,3,5,6-tetrafluoro-4-methoxybenzamide |
| SMILES | COc1c(F)c(F)c(C(=O)NC(=S)Nc2cc(C(C)(C)C)cc(Cl)c2O)c(F)c1F |
| InChI | InChI=1S/C19H17ClF4N2O3S/c1-19(2,3)7-5-8(20)15(27)9(6-7)25-18(30)26-17(28)10-11(21)13(23)16(29-4)14(24)12(10)22/h5-6,27H,1-4H3,(H2,25,26,28,30) |
| InChIKey | NBCNOYDBKGYMQB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|