C18H20Cl2N6S — CID 19343060
1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea (PubChem CID 19343060) has the molecular formula C18H20Cl2N6S and a molecular weight of 423.37 g/mol. Its IUPAC name is 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19343060 |
| Molecular Formula | C18H20Cl2N6S |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[1-[(2,6-dichlorophenyl)methyl]pyrazol-4-yl]-3-[(1-ethyl-3-methylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCn1cc(CNC(=S)Nc2cnn(Cc3c(Cl)cccc3Cl)c2)c(C)n1 |
| InChI | InChI=1S/C18H20Cl2N6S/c1-3-25-9-13(12(2)24-25)7-21-18(27)23-14-8-22-26(10-14)11-15-16(19)5-4-6-17(15)20/h4-6,8-10H,3,7,11H2,1-2H3,(H2,21,23,27) |
| InChIKey | PCLXGZDNGBBZAI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|