C18H16BrClN4S — CID 19679605
1-(4-bromo-2-chlorophenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19679605) has the molecular formula C18H16BrClN4S and a molecular weight of 435.78 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19679605 |
| Molecular Formula | C18H16BrClN4S |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccccc1Cn1cc(NC(=S)Nc2ccc(Br)cc2Cl)cn1 |
| InChI | InChI=1S/C18H16BrClN4S/c1-12-4-2-3-5-13(12)10-24-11-15(9-21-24)22-18(25)23-17-7-6-14(19)8-16(17)20/h2-9,11H,10H2,1H3,(H2,22,23,25) |
| InChIKey | UJFDUPVXRWDZMN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|