C16H17FN6S — CID 19342858
1-(1,3-dimethylpyrazol-4-yl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19342858) has the molecular formula C16H17FN6S and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19342858 |
| Molecular Formula | C16H17FN6S |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1nn(C)cc1NC(=S)Nc1ccn(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C16H17FN6S/c1-11-14(10-22(2)20-11)18-16(24)19-15-7-8-23(21-15)9-12-5-3-4-6-13(12)17/h3-8,10H,9H2,1-2H3,(H2,18,19,21,24) |
| InChIKey | XOSLXGQTMGEXSM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|