C19H24N6S — CID 19469256
1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19469256) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19469256 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[1-(1,3-dimethylpyrazol-4-yl)ethyl]-3-[1-[(2-methylphenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1ccccc1Cn1ccc(NC(=S)NC(C)c2cn(C)nc2C)n1 |
| InChI | InChI=1S/C19H24N6S/c1-13-7-5-6-8-16(13)11-25-10-9-18(23-25)21-19(26)20-14(2)17-12-24(4)22-15(17)3/h5-10,12,14H,11H2,1-4H3,(H2,20,21,23,26) |
| InChIKey | KHNPQTBYUIJBDS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|