C26H17F4N5O — CID 2965391
6-methyl-2-pyridin-2-yl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]quinoline-4-carboxamide (PubChem CID 2965391) has the molecular formula C26H17F4N5O and a molecular weight of 491.45 g/mol. Its IUPAC name is 6-methyl-2-pyridin-2-yl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]quinoline-4-carboxamide.
| Compound Name | 6-methyl-2-pyridin-2-yl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2965391 |
| Molecular Formula | C26H17F4N5O |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 6-methyl-2-pyridin-2-yl-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]quinoline-4-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccccn3)cc(C(=O)Nc3ccn(Cc4c(F)c(F)cc(F)c4F)n3)c2c1 |
| InChI | InChI=1S/C26H17F4N5O/c1-14-5-6-20-15(10-14)16(11-22(32-20)21-4-2-3-8-31-21)26(36)33-23-7-9-35(34-23)13-17-24(29)18(27)12-19(28)25(17)30/h2-12H,13H2,1H3,(H,33,34,36) |
| InChIKey | WWLTUEGKKPSNGL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|