C19H17F2N3O2 — CID 19336243
3-(difluoromethoxy)-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19336243) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3-(difluoromethoxy)-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19336243 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-(difluoromethoxy)-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | Cc1cccc(Cn2cc(NC(=O)c3cccc(OC(F)F)c3)cn2)c1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-13-4-2-5-14(8-13)11-24-12-16(10-22-24)23-18(25)15-6-3-7-17(9-15)26-19(20)21/h2-10,12,19H,11H2,1H3,(H,23,25) |
| InChIKey | ZHOUTDAMJYMFBF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |