C15H14IN5O — CID 19479936
4-iodo-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]-1H-pyrazole-5-carboxamide (PubChem CID 19479936) has the molecular formula C15H14IN5O and a molecular weight of 407.22 g/mol. Its IUPAC name is 4-iodo-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-iodo-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479936 |
| Molecular Formula | C15H14IN5O |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 4-iodo-N-[1-[(3-methylphenyl)methyl]pyrazol-4-yl]-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cccc(Cn2cc(NC(=O)c3[nH]ncc3I)cn2)c1 |
| InChI | InChI=1S/C15H14IN5O/c1-10-3-2-4-11(5-10)8-21-9-12(6-18-21)19-15(22)14-13(16)7-17-20-14/h2-7,9H,8H2,1H3,(H,17,20)(H,19,22) |
| InChIKey | CNVCYZPBFYJMMV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|