C25H29N3O5S — CID 31443585
4-(furan-2-ylmethylsulfamoyl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 31443585) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfamoyl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 4-(furan-2-ylmethylsulfamoyl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 31443585 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-(furan-2-ylmethylsulfamoyl)-N-[(1S)-1-(4-methylphenyl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | Cc1ccc([C@@H](CN2CCOCC2)NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c1-19-4-6-20(7-5-19)24(18-28-12-15-32-16-13-28)27-25(29)21-8-10-23(11-9-21)34(30,31)26-17-22-3-2-14-33-22/h2-11,14,24,26H,12-13,15-18H2,1H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | LYQQCBSODYRCMP-XMMPIXPASA-N |
| XLogP | 2.87 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |