C20H22BrN3O3S — CID 17351966
N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide (PubChem CID 17351966) has the molecular formula C20H22BrN3O3S and a molecular weight of 464.39 g/mol. Its IUPAC name is N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide.
| Compound Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide |
|---|---|
| PubChem CID | 17351966 |
| Molecular Formula | C20H22BrN3O3S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-5-bromo-2-propoxybenzamide |
| SMILES | CCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(N(C)C(C)=O)cc1 |
| InChI | InChI=1S/C20H22BrN3O3S/c1-4-11-27-18-10-5-14(21)12-17(18)19(26)23-20(28)22-15-6-8-16(9-7-15)24(3)13(2)25/h5-10,12H,4,11H2,1-3H3,(H2,22,23,26,28) |
| InChIKey | KAKNGQLJHRLNLC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|