C15H11BrCl2N2O2 — CID 1396132
N-(5-bromo-2-pyridinyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide (PubChem CID 1396132) has the molecular formula C15H11BrCl2N2O2 and a molecular weight of 402.08 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1396132 |
| Molecular Formula | C15H11BrCl2N2O2 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-3-(3,5-dichloro-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C=CC(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C15H11BrCl2N2O2/c1-22-15-9(6-11(17)7-12(15)18)2-5-14(21)20-13-4-3-10(16)8-19-13/h2-8H,1H3,(H,19,20,21) |
| InChIKey | ZMTBMOYNZSXKCT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|