C22H27ClN3O3+ — CID 7551849
(E)-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 7551849) has the molecular formula C22H27ClN3O3+ and a molecular weight of 416.93 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7551849 |
| Molecular Formula | C22H27ClN3O3+ |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (E)-N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-3-(2,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)Nc2cc(Cl)ccc2N2CC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-25-10-12-26(13-11-25)20-7-5-17(23)15-19(20)24-22(27)9-4-16-14-18(28-2)6-8-21(16)29-3/h4-9,14-15H,10-13H2,1-3H3,(H,24,27)/p+1/b9-4+ |
| InChIKey | DBLOOWMXONWVOS-RUDMXATFSA-O |
| XLogP | 2.34 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|