C36H48N4O4S — CID 145112901
5-[[4-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfinylamino]phenyl]piperazin-1-yl]methyl]-2-methoxybenzoic acid;ethane;propane (PubChem CID 145112901) has the molecular formula C36H48N4O4S and a molecular weight of 632.87 g/mol. Its IUPAC name is 5-[[4-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfinylamino]phenyl]piperazin-1-yl]methyl]-2-methoxybenzoic acid;ethane;propane.
| Compound Name | 5-[[4-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfinylamino]phenyl]piperazin-1-yl]methyl]-2-methoxybenzoic acid;ethane;propane |
|---|---|
| PubChem CID | 145112901 |
| Molecular Formula | C36H48N4O4S |
| Molecular Weight | 632.87 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | 5-[[4-[4-[[5-(dimethylamino)naphthalen-1-yl]sulfinylamino]phenyl]piperazin-1-yl]methyl]-2-methoxybenzoic acid;ethane;propane |
| SMILES | CC.CCC.COc1ccc(CN2CCN(c3ccc(NS(=O)c4cccc5c(N(C)C)cccc45)cc3)CC2)cc1C(=O)O |
| InChI | InChI=1S/C31H34N4O4S.C3H8.C2H6/c1-33(2)28-8-4-7-26-25(28)6-5-9-30(26)40(38)32-23-11-13-24(14-12-23)35-18-16-34(17-19-35)21-22-10-15-29(39-3)27(20-22)31(36)37;1-3-2;1-2/h4-15,20,32H,16-19,21H2,1-3H3,(H,36,37);3H2,1-2H3;1-2H3 |
| InChIKey | GQFFYVDBVOMGSI-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.87 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|