C19H30N2O — CID 167678619
4-[(4,4-diethylpiperidin-1-yl)methyl]-N,3-dimethylbenzamide (PubChem CID 167678619) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 4-[(4,4-diethylpiperidin-1-yl)methyl]-N,3-dimethylbenzamide.
| Compound Name | 4-[(4,4-diethylpiperidin-1-yl)methyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 167678619 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 4-[(4,4-diethylpiperidin-1-yl)methyl]-N,3-dimethylbenzamide |
| SMILES | CCC1(CC)CCN(Cc2ccc(C(=O)NC)cc2C)CC1 |
| InChI | InChI=1S/C19H30N2O/c1-5-19(6-2)9-11-21(12-10-19)14-17-8-7-16(13-15(17)3)18(22)20-4/h7-8,13H,5-6,9-12,14H2,1-4H3,(H,20,22) |
| InChIKey | OLAUMBHAOLARFL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |