C22H37FN2OY-2 — CID 167634828
4-[[3,3-di(ethyl)piperidin-1-yl]methyl]-3-fluoro-N-methylbenzamide;ethane;yttrium (PubChem CID 167634828) has the molecular formula C22H37FN2OY-2 and a molecular weight of 453.46 g/mol. Its IUPAC name is 4-[[3,3-di(ethyl)piperidin-1-yl]methyl]-3-fluoro-N-methylbenzamide;ethane;yttrium.
| Compound Name | 4-[[3,3-di(ethyl)piperidin-1-yl]methyl]-3-fluoro-N-methylbenzamide;ethane;yttrium |
|---|---|
| PubChem CID | 167634828 |
| Molecular Formula | C22H37FN2OY-2 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[[3,3-di(ethyl)piperidin-1-yl]methyl]-3-fluoro-N-methylbenzamide;ethane;yttrium |
| SMILES | CC.CC.[CH2-]CC1(C[CH2-])CCCN(Cc2ccc(C(=O)NC)cc2F)C1.[Y] |
| InChI | InChI=1S/C18H25FN2O.2C2H6.Y/c1-4-18(5-2)9-6-10-21(13-18)12-15-8-7-14(11-16(15)19)17(22)20-3;2*1-2;/h7-8,11H,1-2,4-6,9-10,12-13H2,3H3,(H,20,22);2*1-2H3;/q-2;;; |
| InChIKey | YUGBMEPTRDLUKF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|