C14H21BFNO3 — CID 107394509
[3-fluoro-4-[(3-methoxy-3-methylpiperidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 107394509) has the molecular formula C14H21BFNO3 and a molecular weight of 281.14 g/mol. Its IUPAC name is [3-fluoro-4-[(3-methoxy-3-methylpiperidin-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-4-[(3-methoxy-3-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 107394509 |
| Molecular Formula | C14H21BFNO3 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [3-fluoro-4-[(3-methoxy-3-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | COC1(C)CCCN(Cc2ccc(B(O)O)cc2F)C1 |
| InChI | InChI=1S/C14H21BFNO3/c1-14(20-2)6-3-7-17(10-14)9-11-4-5-12(15(18)19)8-13(11)16/h4-5,8,18-19H,3,6-7,9-10H2,1-2H3 |
| InChIKey | LPKVDHWDRCZASH-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|