C14H19BFNO4 — CID 91759296
[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid (PubChem CID 91759296) has the molecular formula C14H19BFNO4 and a molecular weight of 295.12 g/mol. Its IUPAC name is [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid.
| Compound Name | [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 91759296 |
| Molecular Formula | C14H19BFNO4 |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid |
| SMILES | OB(O)c1ccc(CN2CCC3(CC2)OCCO3)c(F)c1 |
| InChI | InChI=1S/C14H19BFNO4/c16-13-9-12(15(18)19)2-1-11(13)10-17-5-3-14(4-6-17)20-7-8-21-14/h1-2,9,18-19H,3-8,10H2 |
| InChIKey | PKCOMAOCGQSQQT-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|