C16H23BFNO2 — CID 63158975
[4-(8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid (PubChem CID 63158975) has the molecular formula C16H23BFNO2 and a molecular weight of 291.17 g/mol. Its IUPAC name is [4-(8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid.
| Compound Name | [4-(8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 63158975 |
| Molecular Formula | C16H23BFNO2 |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [4-(8-azaspiro[4.5]decan-8-ylmethyl)-3-fluorophenyl]boronic acid |
| SMILES | OB(O)c1ccc(CN2CCC3(CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C16H23BFNO2/c18-15-11-14(17(20)21)4-3-13(15)12-19-9-7-16(8-10-19)5-1-2-6-16/h3-4,11,20-21H,1-2,5-10,12H2 |
| InChIKey | HOHZWSOYOZIVNE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|