C14H22BFN2O2 — CID 63635022
[4-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-3-fluorophenyl]boronic acid (PubChem CID 63635022) has the molecular formula C14H22BFN2O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is [4-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 63635022 |
| Molecular Formula | C14H22BFN2O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [4-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-3-fluorophenyl]boronic acid |
| SMILES | CCN1CCN(Cc2ccc(B(O)O)cc2F)CC1C |
| InChI | InChI=1S/C14H22BFN2O2/c1-3-18-7-6-17(9-11(18)2)10-12-4-5-13(15(19)20)8-14(12)16/h4-5,8,11,19-20H,3,6-7,9-10H2,1-2H3 |
| InChIKey | VQMZMERDKAZORH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|