C15H25BN2O3 — CID 63635021
[5-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-2-methoxyphenyl]boronic acid (PubChem CID 63635021) has the molecular formula C15H25BN2O3 and a molecular weight of 292.19 g/mol. Its IUPAC name is [5-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-2-methoxyphenyl]boronic acid.
| Compound Name | [5-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-2-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 63635021 |
| Molecular Formula | C15H25BN2O3 |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [5-[(4-ethyl-3-methylpiperazin-1-yl)methyl]-2-methoxyphenyl]boronic acid |
| SMILES | CCN1CCN(Cc2ccc(OC)c(B(O)O)c2)CC1C |
| InChI | InChI=1S/C15H25BN2O3/c1-4-18-8-7-17(10-12(18)2)11-13-5-6-15(21-3)14(9-13)16(19)20/h5-6,9,12,19-20H,4,7-8,10-11H2,1-3H3 |
| InChIKey | PIVHAYPBRCYLOP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|