C14H22BNO4 — CID 64599663
[2-methoxy-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 64599663) has the molecular formula C14H22BNO4 and a molecular weight of 279.14 g/mol. Its IUPAC name is [2-methoxy-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [2-methoxy-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 64599663 |
| Molecular Formula | C14H22BNO4 |
| Molecular Weight | 279.14 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | [2-methoxy-5-[[3-(methoxymethyl)pyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | COCC1CCN(Cc2ccc(OC)c(B(O)O)c2)C1 |
| InChI | InChI=1S/C14H22BNO4/c1-19-10-12-5-6-16(9-12)8-11-3-4-14(20-2)13(7-11)15(17)18/h3-4,7,12,17-18H,5-6,8-10H2,1-2H3 |
| InChIKey | YNVZBOPGLPSEDC-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.14 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|