C15H24BFN2O2 — CID 63164778
[4-[[3-(diethylamino)pyrrolidin-1-yl]methyl]-3-fluorophenyl]boronic acid (PubChem CID 63164778) has the molecular formula C15H24BFN2O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is [4-[[3-(diethylamino)pyrrolidin-1-yl]methyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[3-(diethylamino)pyrrolidin-1-yl]methyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 63164778 |
| Molecular Formula | C15H24BFN2O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [4-[[3-(diethylamino)pyrrolidin-1-yl]methyl]-3-fluorophenyl]boronic acid |
| SMILES | CCN(CC)C1CCN(Cc2ccc(B(O)O)cc2F)C1 |
| InChI | InChI=1S/C15H24BFN2O2/c1-3-19(4-2)14-7-8-18(11-14)10-12-5-6-13(16(20)21)9-15(12)17/h5-6,9,14,20-21H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | ORUQVIBCDABOJD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|