C12H17BFNO2 — CID 54970567
[3-fluoro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 54970567) has the molecular formula C12H17BFNO2 and a molecular weight of 237.08 g/mol. Its IUPAC name is [3-fluoro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54970567 |
| Molecular Formula | C12H17BFNO2 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | [3-fluoro-4-[(2-methylpyrrolidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | CC1CCCN1Cc1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C12H17BFNO2/c1-9-3-2-6-15(9)8-10-4-5-11(13(16)17)7-12(10)14/h4-5,7,9,16-17H,2-3,6,8H2,1H3 |
| InChIKey | DNFDFBOIIGNVRK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|