C18H25FN2O2 — CID 155598336
4-(2-azaspiro[5.5]undecan-2-ylmethyl)-3-fluoro-N-hydroxybenzamide (PubChem CID 155598336) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-(2-azaspiro[5.5]undecan-2-ylmethyl)-3-fluoro-N-hydroxybenzamide.
| Compound Name | 4-(2-azaspiro[5.5]undecan-2-ylmethyl)-3-fluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 155598336 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-(2-azaspiro[5.5]undecan-2-ylmethyl)-3-fluoro-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2CCCC3(CCCCC3)C2)c(F)c1 |
| InChI | InChI=1S/C18H25FN2O2/c19-16-11-14(17(22)20-23)5-6-15(16)12-21-10-4-9-18(13-21)7-2-1-3-8-18/h5-6,11,23H,1-4,7-10,12-13H2,(H,20,22) |
| InChIKey | ANNRHHAMLQPMHJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|