C16H22ClN3S — CID 102666309
3-chloro-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide (PubChem CID 102666309) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is 3-chloro-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-chloro-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102666309 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-chloro-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide |
| SMILES | CC1CN2CCCC2CN1Cc1ccc(C(N)=S)cc1Cl |
| InChI | InChI=1S/C16H22ClN3S/c1-11-8-19-6-2-3-14(19)10-20(11)9-13-5-4-12(16(18)21)7-15(13)17/h4-5,7,11,14H,2-3,6,8-10H2,1H3,(H2,18,21) |
| InChIKey | UWRYTFGTTYSQSW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|